C22H22F3N3O — CID 118056955
[(2S,5S)-9-(2,6-difluorophenyl)-11-methyl-7,8-diazatricyclo[4.4.1.12,5]dodeca-1(11),7,9-trien-5-yl]-(3-fluoropyrrolidin-1-yl)methanone (PubChem CID 118056955) has the molecular formula C22H22F3N3O and a molecular weight of 401.43 g/mol. Its IUPAC name is [(2S,5S)-9-(2,6-difluorophenyl)-11-methyl-7,8-diazatricyclo[4.4.1.12,5]dodeca-1(11),7,9-trien-5-yl]-(3-fluoropyrrolidin-1-yl)methanone.
| Compound Name | [(2S,5S)-9-(2,6-difluorophenyl)-11-methyl-7,8-diazatricyclo[4.4.1.12,5]dodeca-1(11),7,9-trien-5-yl]-(3-fluoropyrrolidin-1-yl)methanone |
|---|---|
| PubChem CID | 118056955 |
| Molecular Formula | C22H22F3N3O |
| Molecular Weight | 401.43 g/mol |
| Exact Mass | 401.17 |
| IUPAC Name | [(2S,5S)-9-(2,6-difluorophenyl)-11-methyl-7,8-diazatricyclo[4.4.1.12,5]dodeca-1(11),7,9-trien-5-yl]-(3-fluoropyrrolidin-1-yl)methanone |
| SMILES | CC1=C2C=C(c3c(F)cccc3F)N=NC1[C@]1(C(=O)N3CCC(F)C3)CC[C@H]2C1 |
| InChI | InChI=1S/C22H22F3N3O/c1-12-15-9-18(19-16(24)3-2-4-17(19)25)26-27-20(12)22(7-5-13(15)10-22)21(29)28-8-6-14(23)11-28/h2-4,9,13-14,20H,5-8,10-11H2,1H3/t13-,14?,20?,22-/m0/s1 |
| InChIKey | JPUKXNFRHAQMDW-CCOFLLIDSA-N |
| XLogP | 4.83 |
| TPSA | 45.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.43 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |