C34H39NO6 — CID 118057036
1-[(3S,5S)-1-acetyl-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]pyrrolidin-3-yl]hexane-2,5-dione (PubChem CID 118057036) has the molecular formula C34H39NO6 and a molecular weight of 557.69 g/mol. Its IUPAC name is 1-[(3S,5S)-1-acetyl-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]pyrrolidin-3-yl]hexane-2,5-dione.
| Compound Name | 1-[(3S,5S)-1-acetyl-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]pyrrolidin-3-yl]hexane-2,5-dione |
|---|---|
| PubChem CID | 118057036 |
| Molecular Formula | C34H39NO6 |
| Molecular Weight | 557.69 g/mol |
| Exact Mass | 557.28 |
| IUPAC Name | 1-[(3S,5S)-1-acetyl-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]pyrrolidin-3-yl]hexane-2,5-dione |
| SMILES | COc1ccc(C(OC[C@@H]2C[C@@H](CC(=O)CCC(C)=O)CN2C(C)=O)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C34H39NO6/c1-24(36)10-15-31(38)21-26-20-30(35(22-26)25(2)37)23-41-34(27-8-6-5-7-9-27,28-11-16-32(39-3)17-12-28)29-13-18-33(40-4)19-14-29/h5-9,11-14,16-19,26,30H,10,15,20-23H2,1-4H3/t26-,30-/m0/s1 |
| InChIKey | FFFGGXOVXMAXLD-YZNIXAGQSA-N |
| XLogP | 5.58 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.69 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|