C10H12FNO — CID 118057072
(3E,5E)-2-fluoro-5-(5-methyl-1,3-dihydropyrrol-2-ylidene)penta-1,3-dien-3-ol (PubChem CID 118057072) has the molecular formula C10H12FNO and a molecular weight of 181.21 g/mol. Its IUPAC name is (3E,5E)-2-fluoro-5-(5-methyl-1,3-dihydropyrrol-2-ylidene)penta-1,3-dien-3-ol.
| Compound Name | (3E,5E)-2-fluoro-5-(5-methyl-1,3-dihydropyrrol-2-ylidene)penta-1,3-dien-3-ol |
|---|---|
| PubChem CID | 118057072 |
| Molecular Formula | C10H12FNO |
| Molecular Weight | 181.21 g/mol |
| Exact Mass | 181.09 |
| IUPAC Name | (3E,5E)-2-fluoro-5-(5-methyl-1,3-dihydropyrrol-2-ylidene)penta-1,3-dien-3-ol |
| SMILES | C=C(F)/C(O)=C\C=C1/CC=C(C)N1 |
| InChI | InChI=1S/C10H12FNO/c1-7-3-4-9(12-7)5-6-10(13)8(2)11/h3,5-6,12-13H,2,4H2,1H3/b9-5+,10-6+ |
| InChIKey | LZHRHHOQOWRYGA-NXZHAISVSA-N |
| XLogP | 2.69 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.21 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|