C18H25F6O2P — CID 118057326
[3,5-bis(1,1,2-trifluoroethoxy)phenyl]-ditert-butylphosphane (PubChem CID 118057326) has the molecular formula C18H25F6O2P and a molecular weight of 418.36 g/mol. Its IUPAC name is [3,5-bis(1,1,2-trifluoroethoxy)phenyl]-ditert-butylphosphane.
| Compound Name | [3,5-bis(1,1,2-trifluoroethoxy)phenyl]-ditert-butylphosphane |
|---|---|
| PubChem CID | 118057326 |
| Molecular Formula | C18H25F6O2P |
| Molecular Weight | 418.36 g/mol |
| Exact Mass | 418.15 |
| IUPAC Name | [3,5-bis(1,1,2-trifluoroethoxy)phenyl]-ditert-butylphosphane |
| SMILES | CC(C)(C)P(c1cc(OC(F)(F)CF)cc(OC(F)(F)CF)c1)C(C)(C)C |
| InChI | InChI=1S/C18H25F6O2P/c1-15(2,3)27(16(4,5)6)14-8-12(25-17(21,22)10-19)7-13(9-14)26-18(23,24)11-20/h7-9H,10-11H2,1-6H3 |
| InChIKey | IAAJNKFUVAEWML-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.36 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|