About 1-[(4Z)-4-[(E)-2-chloro-3-cyclopropyloxyprop-1-enyl]hepta-4,6-dienyl]pyrrolidine
1-[(4Z)-4-[(E)-2-chloro-3-cyclopropyloxyprop-1-enyl]hepta-4,6-dienyl]pyrrolidine (PubChem CID 118058044) has the molecular formula C17H26ClNO
and a molecular weight of 295.85 g/mol. Its IUPAC name is 1-[(4Z)-4-[(E)-2-chloro-3-cyclopropyloxyprop-1-enyl]hepta-4,6-dienyl]pyrrolidine.
Molecular Properties
| Compound Name | 1-[(4Z)-4-[(E)-2-chloro-3-cyclopropyloxyprop-1-enyl]hepta-4,6-dienyl]pyrrolidine |
| PubChem CID | 118058044 |
| Molecular Formula | C17H26ClNO |
| Molecular Weight | 295.85 g/mol |
| Exact Mass | 295.17 |
| IUPAC Name | 1-[(4Z)-4-[(E)-2-chloro-3-cyclopropyloxyprop-1-enyl]hepta-4,6-dienyl]pyrrolidine |
| SMILES | C=C/C=C(\C=C(\Cl)COC1CC1)CCCN1CCCC1 |
| InChI | InChI=1S/C17H26ClNO/c1-2-6-15(7-5-12-19-10-3-4-11-19)13-16(18)14-20-17-8-9-17/h2,6,13,17H,1,3-5,7-12,14H2/b15-6-,16-13+ |
| InChIKey | DWYXUNRYBIWINV-CHQHTEKXSA-N |
| XLogP | 4.28 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.85 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 1-[(4Z)-4-[(E)-2-chloro-3-cyclopropyloxyprop-1-enyl]hepta-4,6-dienyl]pyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(4Z)-4-[(E)-2-chloro-3-cyclopropyloxyprop-1-enyl]hepta-4,6-dienyl]pyrrolidine?
The IUPAC name of 1-[(4Z)-4-[(E)-2-chloro-3-cyclopropyloxyprop-1-enyl]hepta-4,6-dienyl]pyrrolidine (CID 118058044) is 1-[(4Z)-4-[(E)-2-chloro-3-cyclopropyloxyprop-1-enyl]hepta-4,6-dienyl]pyrrolidine.
What is the SMILES notation for 1-[(4Z)-4-[(E)-2-chloro-3-cyclopropyloxyprop-1-enyl]hepta-4,6-dienyl]pyrrolidine?
The canonical SMILES for 1-[(4Z)-4-[(E)-2-chloro-3-cyclopropyloxyprop-1-enyl]hepta-4,6-dienyl]pyrrolidine is C=C/C=C(\C=C(\Cl)COC1CC1)CCCN1CCCC1.
What is the InChIKey of 1-[(4Z)-4-[(E)-2-chloro-3-cyclopropyloxyprop-1-enyl]hepta-4,6-dienyl]pyrrolidine?
The InChIKey is DWYXUNRYBIWINV-CHQHTEKXSA-N. The full InChI is InChI=1S/C17H26ClNO/c1-2-6-15(7-5-12-19-10-3-4-11-19)13-16(18)14-20-17-8-9-17/h2,6,13,17H,1,3-5,7-12,14H2/b15-6-,16-13+.
What are the key properties of 1-[(4Z)-4-[(E)-2-chloro-3-cyclopropyloxyprop-1-enyl]hepta-4,6-dienyl]pyrrolidine?
1-[(4Z)-4-[(E)-2-chloro-3-cyclopropyloxyprop-1-enyl]hepta-4,6-dienyl]pyrrolidine has a molecular weight of 295.85 g/mol, XLogP of 4.28, 9 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(4Z)-4-[(E)-2-chloro-3-cyclopropyloxyprop-1-enyl]hepta-4,6-dienyl]pyrrolidine is sourced from PubChem (CID 118058044), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).