C22H23N3O6PS3+ — CID 118059015
2-[4-[3-amino-2-butylsulfinyl-6-(1,3-thiazol-2-yl)thieno[2,3-b]pyridin-4-yl]phenoxy]ethylperoxy-hydroxy-oxophosphanium (PubChem CID 118059015) has the molecular formula C22H23N3O6PS3+ and a molecular weight of 552.62 g/mol. Its IUPAC name is 2-[4-[3-amino-2-butylsulfinyl-6-(1,3-thiazol-2-yl)thieno[2,3-b]pyridin-4-yl]phenoxy]ethylperoxy-hydroxy-oxophosphanium.
| Compound Name | 2-[4-[3-amino-2-butylsulfinyl-6-(1,3-thiazol-2-yl)thieno[2,3-b]pyridin-4-yl]phenoxy]ethylperoxy-hydroxy-oxophosphanium |
|---|---|
| PubChem CID | 118059015 |
| Molecular Formula | C22H23N3O6PS3+ |
| Molecular Weight | 552.62 g/mol |
| Exact Mass | 552.05 |
| IUPAC Name | 2-[4-[3-amino-2-butylsulfinyl-6-(1,3-thiazol-2-yl)thieno[2,3-b]pyridin-4-yl]phenoxy]ethylperoxy-hydroxy-oxophosphanium |
| SMILES | CCCCS(=O)c1sc2nc(-c3nccs3)cc(-c3ccc(OCCOO[P+](=O)O)cc3)c2c1N |
| InChI | InChI=1S/C22H22N3O6PS3/c1-2-3-12-35(28)22-19(23)18-16(13-17(25-21(18)34-22)20-24-8-11-33-20)14-4-6-15(7-5-14)29-9-10-30-31-32(26)27/h4-8,11,13H,2-3,9-10,12,23H2,1H3/p+1 |
| InChIKey | XZPKHZQEHVCAST-UHFFFAOYSA-O |
| XLogP | 5.55 |
| TPSA | 133.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.62 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|