C26H30N4O4S3 — CID 118059016
2-[4-[3-amino-2-butylsulfinyl-6-(1,3-thiazol-2-yl)thieno[2,3-b]pyridin-4-yl]phenoxy]ethyl 2-(dimethylamino)acetate (PubChem CID 118059016) has the molecular formula C26H30N4O4S3 and a molecular weight of 558.75 g/mol. Its IUPAC name is 2-[4-[3-amino-2-butylsulfinyl-6-(1,3-thiazol-2-yl)thieno[2,3-b]pyridin-4-yl]phenoxy]ethyl 2-(dimethylamino)acetate.
| Compound Name | 2-[4-[3-amino-2-butylsulfinyl-6-(1,3-thiazol-2-yl)thieno[2,3-b]pyridin-4-yl]phenoxy]ethyl 2-(dimethylamino)acetate |
|---|---|
| PubChem CID | 118059016 |
| Molecular Formula | C26H30N4O4S3 |
| Molecular Weight | 558.75 g/mol |
| Exact Mass | 558.14 |
| IUPAC Name | 2-[4-[3-amino-2-butylsulfinyl-6-(1,3-thiazol-2-yl)thieno[2,3-b]pyridin-4-yl]phenoxy]ethyl 2-(dimethylamino)acetate |
| SMILES | CCCCS(=O)c1sc2nc(-c3nccs3)cc(-c3ccc(OCCOC(=O)CN(C)C)cc3)c2c1N |
| InChI | InChI=1S/C26H30N4O4S3/c1-4-5-14-37(32)26-23(27)22-19(15-20(29-25(22)36-26)24-28-10-13-35-24)17-6-8-18(9-7-17)33-11-12-34-21(31)16-30(2)3/h6-10,13,15H,4-5,11-12,14,16,27H2,1-3H3 |
| InChIKey | ULCOQNVPBWOQQK-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 107.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.75 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|