C14H25N — CID 11805903
(1S,2S,4R,5R,8S)-2,6,7-trimethyl-4-propan-2-ylbicyclo[3.2.1]oct-6-en-8-amine (PubChem CID 11805903) has the molecular formula C14H25N and a molecular weight of 207.36 g/mol. Its IUPAC name is (1S,2S,4R,5R,8S)-2,6,7-trimethyl-4-propan-2-ylbicyclo[3.2.1]oct-6-en-8-amine.
| Compound Name | (1S,2S,4R,5R,8S)-2,6,7-trimethyl-4-propan-2-ylbicyclo[3.2.1]oct-6-en-8-amine |
|---|---|
| PubChem CID | 11805903 |
| Molecular Formula | C14H25N |
| Molecular Weight | 207.36 g/mol |
| Exact Mass | 207.20 |
| IUPAC Name | (1S,2S,4R,5R,8S)-2,6,7-trimethyl-4-propan-2-ylbicyclo[3.2.1]oct-6-en-8-amine |
| SMILES | CC1=C(C)[C@H]2[C@H](N)[C@@H]1[C@@H](C(C)C)C[C@@H]2C |
| InChI | InChI=1S/C14H25N/c1-7(2)11-6-8(3)12-9(4)10(5)13(11)14(12)15/h7-8,11-14H,6,15H2,1-5H3/t8-,11+,12-,13-,14-/m0/s1 |
| InChIKey | PBJHVLWTAPTMFL-DRLPCLEQSA-N |
| XLogP | 3.21 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.36 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|