C19H20ClN5OS3 — CID 118059059
2-(4-chlorobutylsulfinyl)-4-(2,3-dimethylimidazol-4-yl)-6-(1,3-thiazol-2-yl)thieno[2,3-b]pyridin-3-amine (PubChem CID 118059059) has the molecular formula C19H20ClN5OS3 and a molecular weight of 466.06 g/mol. Its IUPAC name is 2-(4-chlorobutylsulfinyl)-4-(2,3-dimethylimidazol-4-yl)-6-(1,3-thiazol-2-yl)thieno[2,3-b]pyridin-3-amine.
| Compound Name | 2-(4-chlorobutylsulfinyl)-4-(2,3-dimethylimidazol-4-yl)-6-(1,3-thiazol-2-yl)thieno[2,3-b]pyridin-3-amine |
|---|---|
| PubChem CID | 118059059 |
| Molecular Formula | C19H20ClN5OS3 |
| Molecular Weight | 466.06 g/mol |
| Exact Mass | 465.05 |
| IUPAC Name | 2-(4-chlorobutylsulfinyl)-4-(2,3-dimethylimidazol-4-yl)-6-(1,3-thiazol-2-yl)thieno[2,3-b]pyridin-3-amine |
| SMILES | Cc1ncc(-c2cc(-c3nccs3)nc3sc(S(=O)CCCCCl)c(N)c23)n1C |
| InChI | InChI=1S/C19H20ClN5OS3/c1-11-23-10-14(25(11)2)12-9-13(17-22-6-7-27-17)24-18-15(12)16(21)19(28-18)29(26)8-4-3-5-20/h6-7,9-10H,3-5,8,21H2,1-2H3 |
| InChIKey | BOURQOHZCWCSEH-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 86.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.06 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|