C19H21N5O2S3 — CID 118059078
4-(2,3-dimethylimidazol-4-yl)-2-(2-ethoxyethylsulfinyl)-6-(1,3-thiazol-2-yl)thieno[2,3-b]pyridin-3-amine (PubChem CID 118059078) has the molecular formula C19H21N5O2S3 and a molecular weight of 447.61 g/mol. Its IUPAC name is 4-(2,3-dimethylimidazol-4-yl)-2-(2-ethoxyethylsulfinyl)-6-(1,3-thiazol-2-yl)thieno[2,3-b]pyridin-3-amine.
| Compound Name | 4-(2,3-dimethylimidazol-4-yl)-2-(2-ethoxyethylsulfinyl)-6-(1,3-thiazol-2-yl)thieno[2,3-b]pyridin-3-amine |
|---|---|
| PubChem CID | 118059078 |
| Molecular Formula | C19H21N5O2S3 |
| Molecular Weight | 447.61 g/mol |
| Exact Mass | 447.09 |
| IUPAC Name | 4-(2,3-dimethylimidazol-4-yl)-2-(2-ethoxyethylsulfinyl)-6-(1,3-thiazol-2-yl)thieno[2,3-b]pyridin-3-amine |
| SMILES | CCOCCS(=O)c1sc2nc(-c3nccs3)cc(-c3cnc(C)n3C)c2c1N |
| InChI | InChI=1S/C19H21N5O2S3/c1-4-26-6-8-29(25)19-16(20)15-12(14-10-22-11(2)24(14)3)9-13(23-18(15)28-19)17-21-5-7-27-17/h5,7,9-10H,4,6,8,20H2,1-3H3 |
| InChIKey | ZAOVRHAWEOBXQA-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 95.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.61 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|