About 2-butylsulfinyl-6-(1,3-oxazol-2-yl)-4-phenylthieno[2,3-b]pyridin-3-amine
2-butylsulfinyl-6-(1,3-oxazol-2-yl)-4-phenylthieno[2,3-b]pyridin-3-amine (PubChem CID 118059100) has the molecular formula C20H19N3O2S2
and a molecular weight of 397.53 g/mol. Its IUPAC name is 2-butylsulfinyl-6-(1,3-oxazol-2-yl)-4-phenylthieno[2,3-b]pyridin-3-amine.
Molecular Properties
| Compound Name | 2-butylsulfinyl-6-(1,3-oxazol-2-yl)-4-phenylthieno[2,3-b]pyridin-3-amine |
| PubChem CID | 118059100 |
| Molecular Formula | C20H19N3O2S2 |
| Molecular Weight | 397.53 g/mol |
| Exact Mass | 397.09 |
| IUPAC Name | 2-butylsulfinyl-6-(1,3-oxazol-2-yl)-4-phenylthieno[2,3-b]pyridin-3-amine |
| SMILES | CCCCS(=O)c1sc2nc(-c3ncco3)cc(-c3ccccc3)c2c1N |
| InChI | InChI=1S/C20H19N3O2S2/c1-2-3-11-27(24)20-17(21)16-14(13-7-5-4-6-8-13)12-15(23-19(16)26-20)18-22-9-10-25-18/h4-10,12H,2-3,11,21H2,1H3 |
| InChIKey | CCQMRIVQGYIMSI-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 82.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 397.53 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-butylsulfinyl-6-(1,3-oxazol-2-yl)-4-phenylthieno[2,3-b]pyridin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butylsulfinyl-6-(1,3-oxazol-2-yl)-4-phenylthieno[2,3-b]pyridin-3-amine?
The IUPAC name of 2-butylsulfinyl-6-(1,3-oxazol-2-yl)-4-phenylthieno[2,3-b]pyridin-3-amine (CID 118059100) is 2-butylsulfinyl-6-(1,3-oxazol-2-yl)-4-phenylthieno[2,3-b]pyridin-3-amine.
What is the SMILES notation for 2-butylsulfinyl-6-(1,3-oxazol-2-yl)-4-phenylthieno[2,3-b]pyridin-3-amine?
The canonical SMILES for 2-butylsulfinyl-6-(1,3-oxazol-2-yl)-4-phenylthieno[2,3-b]pyridin-3-amine is CCCCS(=O)c1sc2nc(-c3ncco3)cc(-c3ccccc3)c2c1N.
What is the InChIKey of 2-butylsulfinyl-6-(1,3-oxazol-2-yl)-4-phenylthieno[2,3-b]pyridin-3-amine?
The InChIKey is CCQMRIVQGYIMSI-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H19N3O2S2/c1-2-3-11-27(24)20-17(21)16-14(13-7-5-4-6-8-13)12-15(23-19(16)26-20)18-22-9-10-25-18/h4-10,12H,2-3,11,21H2,1H3.
What are the key properties of 2-butylsulfinyl-6-(1,3-oxazol-2-yl)-4-phenylthieno[2,3-b]pyridin-3-amine?
2-butylsulfinyl-6-(1,3-oxazol-2-yl)-4-phenylthieno[2,3-b]pyridin-3-amine has a molecular weight of 397.53 g/mol, XLogP of 5.11, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butylsulfinyl-6-(1,3-oxazol-2-yl)-4-phenylthieno[2,3-b]pyridin-3-amine is sourced from PubChem (CID 118059100), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).