C18H13N3O2S2 — CID 118059112
4-methyl-10-(1,3-oxazol-2-yl)-12-phenyl-5λ4,7-dithia-3,9-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9,11-tetraene 5-oxide (PubChem CID 118059112) has the molecular formula C18H13N3O2S2 and a molecular weight of 367.46 g/mol. Its IUPAC name is 4-methyl-10-(1,3-oxazol-2-yl)-12-phenyl-5λ4,7-dithia-3,9-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9,11-tetraene 5-oxide.
| Compound Name | 4-methyl-10-(1,3-oxazol-2-yl)-12-phenyl-5λ4,7-dithia-3,9-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9,11-tetraene 5-oxide |
|---|---|
| PubChem CID | 118059112 |
| Molecular Formula | C18H13N3O2S2 |
| Molecular Weight | 367.46 g/mol |
| Exact Mass | 367.04 |
| IUPAC Name | 4-methyl-10-(1,3-oxazol-2-yl)-12-phenyl-5λ4,7-dithia-3,9-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9,11-tetraene 5-oxide |
| SMILES | CC1Nc2c(sc3nc(-c4ncco4)cc(-c4ccccc4)c23)S1=O |
| InChI | InChI=1S/C18H13N3O2S2/c1-10-20-15-14-12(11-5-3-2-4-6-11)9-13(16-19-7-8-23-16)21-17(14)24-18(15)25(10)22/h2-10,20H,1H3 |
| InChIKey | VNCZDOFJOSZFPB-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.46 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |