C20H31NO — CID 118059284
(3E,4Z)-3-[[(2E,4E)-hexa-2,4-dienoxy]methylidene]-N-prop-2-enyl-N-propylhepta-4,6-dien-1-amine (PubChem CID 118059284) has the molecular formula C20H31NO and a molecular weight of 301.47 g/mol. Its IUPAC name is (3E,4Z)-3-[[(2E,4E)-hexa-2,4-dienoxy]methylidene]-N-prop-2-enyl-N-propylhepta-4,6-dien-1-amine.
| Compound Name | (3E,4Z)-3-[[(2E,4E)-hexa-2,4-dienoxy]methylidene]-N-prop-2-enyl-N-propylhepta-4,6-dien-1-amine |
|---|---|
| PubChem CID | 118059284 |
| Molecular Formula | C20H31NO |
| Molecular Weight | 301.47 g/mol |
| Exact Mass | 301.24 |
| IUPAC Name | (3E,4Z)-3-[[(2E,4E)-hexa-2,4-dienoxy]methylidene]-N-prop-2-enyl-N-propylhepta-4,6-dien-1-amine |
| SMILES | C=C/C=C\C(=C\OC/C=C/C=C/C)CCN(CC=C)CCC |
| InChI | InChI=1S/C20H31NO/c1-5-9-11-12-18-22-19-20(13-10-6-2)14-17-21(15-7-3)16-8-4/h5-7,9-13,19H,2-3,8,14-18H2,1,4H3/b9-5+,12-11+,13-10-,20-19- |
| InChIKey | WHKCYIVRTONJEQ-LPUDWINWSA-N |
| XLogP | 5.05 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.47 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|