C26H20FN3O3 — CID 118059307
4-[6-(3,5-dimethyl-1,2-oxazol-4-yl)-1-[(2-fluorophenyl)methyl]pyrrolo[3,2-b]pyridin-3-yl]benzoic acid (PubChem CID 118059307) has the molecular formula C26H20FN3O3 and a molecular weight of 441.46 g/mol. Its IUPAC name is 4-[6-(3,5-dimethyl-1,2-oxazol-4-yl)-1-[(2-fluorophenyl)methyl]pyrrolo[3,2-b]pyridin-3-yl]benzoic acid.
| Compound Name | 4-[6-(3,5-dimethyl-1,2-oxazol-4-yl)-1-[(2-fluorophenyl)methyl]pyrrolo[3,2-b]pyridin-3-yl]benzoic acid |
|---|---|
| PubChem CID | 118059307 |
| Molecular Formula | C26H20FN3O3 |
| Molecular Weight | 441.46 g/mol |
| Exact Mass | 441.15 |
| IUPAC Name | 4-[6-(3,5-dimethyl-1,2-oxazol-4-yl)-1-[(2-fluorophenyl)methyl]pyrrolo[3,2-b]pyridin-3-yl]benzoic acid |
| SMILES | Cc1noc(C)c1-c1cnc2c(-c3ccc(C(=O)O)cc3)cn(Cc3ccccc3F)c2c1 |
| InChI | InChI=1S/C26H20FN3O3/c1-15-24(16(2)33-29-15)20-11-23-25(28-12-20)21(17-7-9-18(10-8-17)26(31)32)14-30(23)13-19-5-3-4-6-22(19)27/h3-12,14H,13H2,1-2H3,(H,31,32) |
| InChIKey | FSHQGHDZDPULAU-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 81.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.46 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|