C28H29FN4O4 — CID 118059355
6-(2-fluoro-4-phenylmethoxyphenyl)-N-(methoxymethyl)-3-methyl-1-(oxan-2-yl)pyrazolo[5,4-b]pyridine-4-carboxamide (PubChem CID 118059355) has the molecular formula C28H29FN4O4 and a molecular weight of 504.56 g/mol. Its IUPAC name is 6-(2-fluoro-4-phenylmethoxyphenyl)-N-(methoxymethyl)-3-methyl-1-(oxan-2-yl)pyrazolo[5,4-b]pyridine-4-carboxamide.
| Compound Name | 6-(2-fluoro-4-phenylmethoxyphenyl)-N-(methoxymethyl)-3-methyl-1-(oxan-2-yl)pyrazolo[5,4-b]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 118059355 |
| Molecular Formula | C28H29FN4O4 |
| Molecular Weight | 504.56 g/mol |
| Exact Mass | 504.22 |
| IUPAC Name | 6-(2-fluoro-4-phenylmethoxyphenyl)-N-(methoxymethyl)-3-methyl-1-(oxan-2-yl)pyrazolo[5,4-b]pyridine-4-carboxamide |
| SMILES | COCNC(=O)c1cc(-c2ccc(OCc3ccccc3)cc2F)nc2c1c(C)nn2C1CCCCO1 |
| InChI | InChI=1S/C28H29FN4O4/c1-18-26-22(28(34)30-17-35-2)15-24(31-27(26)33(32-18)25-10-6-7-13-36-25)21-12-11-20(14-23(21)29)37-16-19-8-4-3-5-9-19/h3-5,8-9,11-12,14-15,25H,6-7,10,13,16-17H2,1-2H3,(H,30,34) |
| InChIKey | ZGGQVFUIXCIOPN-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 87.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.56 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|