C26H26F3N5O2 — CID 118059509
5-[6-(3,5-dimethyl-1,2-oxazol-4-yl)-1-[(1,4,4-trifluorocyclohexyl)methyl]pyrrolo[3,2-b]pyridin-3-yl]-N-methylpyridine-2-carboxamide (PubChem CID 118059509) has the molecular formula C26H26F3N5O2 and a molecular weight of 497.52 g/mol. Its IUPAC name is 5-[6-(3,5-dimethyl-1,2-oxazol-4-yl)-1-[(1,4,4-trifluorocyclohexyl)methyl]pyrrolo[3,2-b]pyridin-3-yl]-N-methylpyridine-2-carboxamide.
| Compound Name | 5-[6-(3,5-dimethyl-1,2-oxazol-4-yl)-1-[(1,4,4-trifluorocyclohexyl)methyl]pyrrolo[3,2-b]pyridin-3-yl]-N-methylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 118059509 |
| Molecular Formula | C26H26F3N5O2 |
| Molecular Weight | 497.52 g/mol |
| Exact Mass | 497.20 |
| IUPAC Name | 5-[6-(3,5-dimethyl-1,2-oxazol-4-yl)-1-[(1,4,4-trifluorocyclohexyl)methyl]pyrrolo[3,2-b]pyridin-3-yl]-N-methylpyridine-2-carboxamide |
| SMILES | CNC(=O)c1ccc(-c2cn(CC3(F)CCC(F)(F)CC3)c3cc(-c4c(C)noc4C)cnc23)cn1 |
| InChI | InChI=1S/C26H26F3N5O2/c1-15-22(16(2)36-33-15)18-10-21-23(32-12-18)19(17-4-5-20(31-11-17)24(35)30-3)13-34(21)14-25(27)6-8-26(28,29)9-7-25/h4-5,10-13H,6-9,14H2,1-3H3,(H,30,35) |
| InChIKey | RVOQTBPGKMTCCS-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 85.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.52 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|