C24H24F5N5O — CID 118059543
4-[1-[(4,4-difluorocyclohexyl)methyl]-3-[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]pyrrolo[3,2-b]pyridin-6-yl]-3,5-dimethyl-1,2-oxazole (PubChem CID 118059543) has the molecular formula C24H24F5N5O and a molecular weight of 493.48 g/mol. Its IUPAC name is 4-[1-[(4,4-difluorocyclohexyl)methyl]-3-[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]pyrrolo[3,2-b]pyridin-6-yl]-3,5-dimethyl-1,2-oxazole.
| Compound Name | 4-[1-[(4,4-difluorocyclohexyl)methyl]-3-[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]pyrrolo[3,2-b]pyridin-6-yl]-3,5-dimethyl-1,2-oxazole |
|---|---|
| PubChem CID | 118059543 |
| Molecular Formula | C24H24F5N5O |
| Molecular Weight | 493.48 g/mol |
| Exact Mass | 493.19 |
| IUPAC Name | 4-[1-[(4,4-difluorocyclohexyl)methyl]-3-[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]pyrrolo[3,2-b]pyridin-6-yl]-3,5-dimethyl-1,2-oxazole |
| SMILES | Cc1noc(C)c1-c1cnc2c(-c3cnn(CC(F)(F)F)c3)cn(CC3CCC(F)(F)CC3)c2c1 |
| InChI | InChI=1S/C24H24F5N5O/c1-14-21(15(2)35-32-14)17-7-20-22(30-8-17)19(18-9-31-34(11-18)13-24(27,28)29)12-33(20)10-16-3-5-23(25,26)6-4-16/h7-9,11-12,16H,3-6,10,13H2,1-2H3 |
| InChIKey | QHYWUGSWLDACMZ-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 61.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.48 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|