C18H20F2N4O — CID 118059550
4-[1-[(4,4-difluorocyclohexyl)methyl]pyrrolo[3,2-b]pyridin-6-yl]-3-methyl-1,2-oxazol-5-amine (PubChem CID 118059550) has the molecular formula C18H20F2N4O and a molecular weight of 346.38 g/mol. Its IUPAC name is 4-[1-[(4,4-difluorocyclohexyl)methyl]pyrrolo[3,2-b]pyridin-6-yl]-3-methyl-1,2-oxazol-5-amine.
| Compound Name | 4-[1-[(4,4-difluorocyclohexyl)methyl]pyrrolo[3,2-b]pyridin-6-yl]-3-methyl-1,2-oxazol-5-amine |
|---|---|
| PubChem CID | 118059550 |
| Molecular Formula | C18H20F2N4O |
| Molecular Weight | 346.38 g/mol |
| Exact Mass | 346.16 |
| IUPAC Name | 4-[1-[(4,4-difluorocyclohexyl)methyl]pyrrolo[3,2-b]pyridin-6-yl]-3-methyl-1,2-oxazol-5-amine |
| SMILES | Cc1noc(N)c1-c1cnc2ccn(CC3CCC(F)(F)CC3)c2c1 |
| InChI | InChI=1S/C18H20F2N4O/c1-11-16(17(21)25-23-11)13-8-15-14(22-9-13)4-7-24(15)10-12-2-5-18(19,20)6-3-12/h4,7-9,12H,2-3,5-6,10,21H2,1H3 |
| InChIKey | NVGJZGVHIWCKLC-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 69.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.38 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|