C19H22F2N4 — CID 118059661
1-[(4,4-difluorocyclohexyl)methyl]-6-(1,5-dimethylpyrazol-4-yl)pyrrolo[3,2-b]pyridine (PubChem CID 118059661) has the molecular formula C19H22F2N4 and a molecular weight of 344.41 g/mol. Its IUPAC name is 1-[(4,4-difluorocyclohexyl)methyl]-6-(1,5-dimethylpyrazol-4-yl)pyrrolo[3,2-b]pyridine.
| Compound Name | 1-[(4,4-difluorocyclohexyl)methyl]-6-(1,5-dimethylpyrazol-4-yl)pyrrolo[3,2-b]pyridine |
|---|---|
| PubChem CID | 118059661 |
| Molecular Formula | C19H22F2N4 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.18 |
| IUPAC Name | 1-[(4,4-difluorocyclohexyl)methyl]-6-(1,5-dimethylpyrazol-4-yl)pyrrolo[3,2-b]pyridine |
| SMILES | Cc1c(-c2cnc3ccn(CC4CCC(F)(F)CC4)c3c2)cnn1C |
| InChI | InChI=1S/C19H22F2N4/c1-13-16(11-23-24(13)2)15-9-18-17(22-10-15)5-8-25(18)12-14-3-6-19(20,21)7-4-14/h5,8-11,14H,3-4,6-7,12H2,1-2H3 |
| InChIKey | BHQOPSWOSOSXDC-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 35.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|