C24H23F6N5O — CID 118059676
3,5-dimethyl-4-[1-[(1,4,4-trifluorocyclohexyl)methyl]-3-[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]pyrrolo[3,2-b]pyridin-6-yl]-1,2-oxazole (PubChem CID 118059676) has the molecular formula C24H23F6N5O and a molecular weight of 511.47 g/mol. Its IUPAC name is 3,5-dimethyl-4-[1-[(1,4,4-trifluorocyclohexyl)methyl]-3-[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]pyrrolo[3,2-b]pyridin-6-yl]-1,2-oxazole.
| Compound Name | 3,5-dimethyl-4-[1-[(1,4,4-trifluorocyclohexyl)methyl]-3-[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]pyrrolo[3,2-b]pyridin-6-yl]-1,2-oxazole |
|---|---|
| PubChem CID | 118059676 |
| Molecular Formula | C24H23F6N5O |
| Molecular Weight | 511.47 g/mol |
| Exact Mass | 511.18 |
| IUPAC Name | 3,5-dimethyl-4-[1-[(1,4,4-trifluorocyclohexyl)methyl]-3-[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]pyrrolo[3,2-b]pyridin-6-yl]-1,2-oxazole |
| SMILES | Cc1noc(C)c1-c1cnc2c(-c3cnn(CC(F)(F)F)c3)cn(CC3(F)CCC(F)(F)CC3)c2c1 |
| InChI | InChI=1S/C24H23F6N5O/c1-14-20(15(2)36-33-14)16-7-19-21(31-8-16)18(17-9-32-35(10-17)13-24(28,29)30)11-34(19)12-22(25)3-5-23(26,27)6-4-22/h7-11H,3-6,12-13H2,1-2H3 |
| InChIKey | LQOMVCGXZJVIJL-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 61.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.47 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|