C22H23F2N3O2 — CID 118059691
3-[1-[(4,4-difluorocyclohexyl)methyl]-6-(3,5-dimethyl-1,2-oxazol-4-yl)pyrrolo[3,2-b]pyridin-3-yl]prop-2-yn-1-ol (PubChem CID 118059691) has the molecular formula C22H23F2N3O2 and a molecular weight of 399.44 g/mol. Its IUPAC name is 3-[1-[(4,4-difluorocyclohexyl)methyl]-6-(3,5-dimethyl-1,2-oxazol-4-yl)pyrrolo[3,2-b]pyridin-3-yl]prop-2-yn-1-ol.
| Compound Name | 3-[1-[(4,4-difluorocyclohexyl)methyl]-6-(3,5-dimethyl-1,2-oxazol-4-yl)pyrrolo[3,2-b]pyridin-3-yl]prop-2-yn-1-ol |
|---|---|
| PubChem CID | 118059691 |
| Molecular Formula | C22H23F2N3O2 |
| Molecular Weight | 399.44 g/mol |
| Exact Mass | 399.18 |
| IUPAC Name | 3-[1-[(4,4-difluorocyclohexyl)methyl]-6-(3,5-dimethyl-1,2-oxazol-4-yl)pyrrolo[3,2-b]pyridin-3-yl]prop-2-yn-1-ol |
| SMILES | Cc1noc(C)c1-c1cnc2c(C#CCO)cn(CC3CCC(F)(F)CC3)c2c1 |
| InChI | InChI=1S/C22H23F2N3O2/c1-14-20(15(2)29-26-14)18-10-19-21(25-11-18)17(4-3-9-28)13-27(19)12-16-5-7-22(23,24)8-6-16/h10-11,13,16,28H,5-9,12H2,1-2H3 |
| InChIKey | FNORQZXMZDDHAO-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 64.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.44 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|