C20H21F2N3O — CID 118059692
1-[(4,4-difluorocyclohexyl)methyl]-6-(6-methoxy-3-pyridinyl)pyrrolo[3,2-b]pyridine (PubChem CID 118059692) has the molecular formula C20H21F2N3O and a molecular weight of 357.40 g/mol. Its IUPAC name is 1-[(4,4-difluorocyclohexyl)methyl]-6-(6-methoxy-3-pyridinyl)pyrrolo[3,2-b]pyridine.
| Compound Name | 1-[(4,4-difluorocyclohexyl)methyl]-6-(6-methoxy-3-pyridinyl)pyrrolo[3,2-b]pyridine |
|---|---|
| PubChem CID | 118059692 |
| Molecular Formula | C20H21F2N3O |
| Molecular Weight | 357.40 g/mol |
| Exact Mass | 357.17 |
| IUPAC Name | 1-[(4,4-difluorocyclohexyl)methyl]-6-(6-methoxy-3-pyridinyl)pyrrolo[3,2-b]pyridine |
| SMILES | COc1ccc(-c2cnc3ccn(CC4CCC(F)(F)CC4)c3c2)cn1 |
| InChI | InChI=1S/C20H21F2N3O/c1-26-19-3-2-15(11-24-19)16-10-18-17(23-12-16)6-9-25(18)13-14-4-7-20(21,22)8-5-14/h2-3,6,9-12,14H,4-5,7-8,13H2,1H3 |
| InChIKey | CIHLMXPBBWPOLP-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.40 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|