C23H24F5N7 — CID 118059767
1-[(4,4-difluorocyclohexyl)methyl]-6-(3,5-dimethyltriazol-4-yl)-3-[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]pyrrolo[3,2-b]pyridine (PubChem CID 118059767) has the molecular formula C23H24F5N7 and a molecular weight of 493.48 g/mol. Its IUPAC name is 1-[(4,4-difluorocyclohexyl)methyl]-6-(3,5-dimethyltriazol-4-yl)-3-[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]pyrrolo[3,2-b]pyridine.
| Compound Name | 1-[(4,4-difluorocyclohexyl)methyl]-6-(3,5-dimethyltriazol-4-yl)-3-[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]pyrrolo[3,2-b]pyridine |
|---|---|
| PubChem CID | 118059767 |
| Molecular Formula | C23H24F5N7 |
| Molecular Weight | 493.48 g/mol |
| Exact Mass | 493.20 |
| IUPAC Name | 1-[(4,4-difluorocyclohexyl)methyl]-6-(3,5-dimethyltriazol-4-yl)-3-[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]pyrrolo[3,2-b]pyridine |
| SMILES | Cc1nnn(C)c1-c1cnc2c(-c3cnn(CC(F)(F)F)c3)cn(CC3CCC(F)(F)CC3)c2c1 |
| InChI | InChI=1S/C23H24F5N7/c1-14-21(33(2)32-31-14)16-7-19-20(29-8-16)18(17-9-30-35(11-17)13-23(26,27)28)12-34(19)10-15-3-5-22(24,25)6-4-15/h7-9,11-12,15H,3-6,10,13H2,1-2H3 |
| InChIKey | YBLPAUZBPXRQOM-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 66.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.48 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|