C18H21F2N5 — CID 118059804
1-[(4,4-difluorocyclohexyl)methyl]-6-(3,5-dimethyltriazol-4-yl)pyrrolo[3,2-b]pyridine (PubChem CID 118059804) has the molecular formula C18H21F2N5 and a molecular weight of 345.40 g/mol. Its IUPAC name is 1-[(4,4-difluorocyclohexyl)methyl]-6-(3,5-dimethyltriazol-4-yl)pyrrolo[3,2-b]pyridine.
| Compound Name | 1-[(4,4-difluorocyclohexyl)methyl]-6-(3,5-dimethyltriazol-4-yl)pyrrolo[3,2-b]pyridine |
|---|---|
| PubChem CID | 118059804 |
| Molecular Formula | C18H21F2N5 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.18 |
| IUPAC Name | 1-[(4,4-difluorocyclohexyl)methyl]-6-(3,5-dimethyltriazol-4-yl)pyrrolo[3,2-b]pyridine |
| SMILES | Cc1nnn(C)c1-c1cnc2ccn(CC3CCC(F)(F)CC3)c2c1 |
| InChI | InChI=1S/C18H21F2N5/c1-12-17(24(2)23-22-12)14-9-16-15(21-10-14)5-8-25(16)11-13-3-6-18(19,20)7-4-13/h5,8-10,13H,3-4,6-7,11H2,1-2H3 |
| InChIKey | SGLKDKZLUFLXGZ-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 48.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|