C26H24F3N7O — CID 118059856
3,5-dimethyl-4-[3-[4-(2H-tetrazol-5-yl)phenyl]-1-[(1,4,4-trifluorocyclohexyl)methyl]pyrrolo[3,2-b]pyridin-6-yl]-1,2-oxazole (PubChem CID 118059856) has the molecular formula C26H24F3N7O and a molecular weight of 507.52 g/mol. Its IUPAC name is 3,5-dimethyl-4-[3-[4-(2H-tetrazol-5-yl)phenyl]-1-[(1,4,4-trifluorocyclohexyl)methyl]pyrrolo[3,2-b]pyridin-6-yl]-1,2-oxazole.
| Compound Name | 3,5-dimethyl-4-[3-[4-(2H-tetrazol-5-yl)phenyl]-1-[(1,4,4-trifluorocyclohexyl)methyl]pyrrolo[3,2-b]pyridin-6-yl]-1,2-oxazole |
|---|---|
| PubChem CID | 118059856 |
| Molecular Formula | C26H24F3N7O |
| Molecular Weight | 507.52 g/mol |
| Exact Mass | 507.20 |
| IUPAC Name | 3,5-dimethyl-4-[3-[4-(2H-tetrazol-5-yl)phenyl]-1-[(1,4,4-trifluorocyclohexyl)methyl]pyrrolo[3,2-b]pyridin-6-yl]-1,2-oxazole |
| SMILES | Cc1noc(C)c1-c1cnc2c(-c3ccc(-c4nn[nH]n4)cc3)cn(CC3(F)CCC(F)(F)CC3)c2c1 |
| InChI | InChI=1S/C26H24F3N7O/c1-15-22(16(2)37-33-15)19-11-21-23(30-12-19)20(17-3-5-18(6-4-17)24-31-34-35-32-24)13-36(21)14-25(27)7-9-26(28,29)10-8-25/h3-6,11-13H,7-10,14H2,1-2H3,(H,31,32,34,35) |
| InChIKey | PKCZCKZMKYYAKB-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 98.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.52 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|