C18H20F2N4 — CID 118059859
1-[(4,4-difluorocyclohexyl)methyl]-6-(5-methyl-1H-pyrazol-4-yl)pyrrolo[3,2-b]pyridine (PubChem CID 118059859) has the molecular formula C18H20F2N4 and a molecular weight of 330.38 g/mol. Its IUPAC name is 1-[(4,4-difluorocyclohexyl)methyl]-6-(5-methyl-1H-pyrazol-4-yl)pyrrolo[3,2-b]pyridine.
| Compound Name | 1-[(4,4-difluorocyclohexyl)methyl]-6-(5-methyl-1H-pyrazol-4-yl)pyrrolo[3,2-b]pyridine |
|---|---|
| PubChem CID | 118059859 |
| Molecular Formula | C18H20F2N4 |
| Molecular Weight | 330.38 g/mol |
| Exact Mass | 330.17 |
| IUPAC Name | 1-[(4,4-difluorocyclohexyl)methyl]-6-(5-methyl-1H-pyrazol-4-yl)pyrrolo[3,2-b]pyridine |
| SMILES | Cc1[nH]ncc1-c1cnc2ccn(CC3CCC(F)(F)CC3)c2c1 |
| InChI | InChI=1S/C18H20F2N4/c1-12-15(10-22-23-12)14-8-17-16(21-9-14)4-7-24(17)11-13-2-5-18(19,20)6-3-13/h4,7-10,13H,2-3,5-6,11H2,1H3,(H,22,23) |
| InChIKey | WOYNTJHTRHIYAG-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.38 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|