About (4-methylphenyl) N,N-dimethylcarbamodithioate
(4-methylphenyl) N,N-dimethylcarbamodithioate (PubChem CID 11805987) has the molecular formula C10H13NS2
and a molecular weight of 211.35 g/mol. Its IUPAC name is (4-methylphenyl) N,N-dimethylcarbamodithioate.
Molecular Properties
| Compound Name | (4-methylphenyl) N,N-dimethylcarbamodithioate |
| PubChem CID | 11805987 |
| Molecular Formula | C10H13NS2 |
| Molecular Weight | 211.35 g/mol |
| Exact Mass | 211.05 |
| IUPAC Name | (4-methylphenyl) N,N-dimethylcarbamodithioate |
| SMILES | Cc1ccc(SC(=S)N(C)C)cc1 |
| InChI | InChI=1S/C10H13NS2/c1-8-4-6-9(7-5-8)13-10(12)11(2)3/h4-7H,1-3H3 |
| InChIKey | FTOHIVXNHNGXIS-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.35 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze (4-methylphenyl) N,N-dimethylcarbamodithioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-methylphenyl) N,N-dimethylcarbamodithioate?
The IUPAC name of (4-methylphenyl) N,N-dimethylcarbamodithioate (CID 11805987) is (4-methylphenyl) N,N-dimethylcarbamodithioate.
What is the SMILES notation for (4-methylphenyl) N,N-dimethylcarbamodithioate?
The canonical SMILES for (4-methylphenyl) N,N-dimethylcarbamodithioate is Cc1ccc(SC(=S)N(C)C)cc1.
What is the InChIKey of (4-methylphenyl) N,N-dimethylcarbamodithioate?
The InChIKey is FTOHIVXNHNGXIS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NS2/c1-8-4-6-9(7-5-8)13-10(12)11(2)3/h4-7H,1-3H3.
What are the key properties of (4-methylphenyl) N,N-dimethylcarbamodithioate?
(4-methylphenyl) N,N-dimethylcarbamodithioate has a molecular weight of 211.35 g/mol, XLogP of 2.93, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4-methylphenyl) N,N-dimethylcarbamodithioate is sourced from PubChem (CID 11805987), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).