C17H14IN5O — CID 118059876
4-[3-iodo-1-(pyrimidin-2-ylmethyl)pyrrolo[3,2-b]pyridin-6-yl]-3,5-dimethyl-1,2-oxazole (PubChem CID 118059876) has the molecular formula C17H14IN5O and a molecular weight of 431.24 g/mol. Its IUPAC name is 4-[3-iodo-1-(pyrimidin-2-ylmethyl)pyrrolo[3,2-b]pyridin-6-yl]-3,5-dimethyl-1,2-oxazole.
| Compound Name | 4-[3-iodo-1-(pyrimidin-2-ylmethyl)pyrrolo[3,2-b]pyridin-6-yl]-3,5-dimethyl-1,2-oxazole |
|---|---|
| PubChem CID | 118059876 |
| Molecular Formula | C17H14IN5O |
| Molecular Weight | 431.24 g/mol |
| Exact Mass | 431.02 |
| IUPAC Name | 4-[3-iodo-1-(pyrimidin-2-ylmethyl)pyrrolo[3,2-b]pyridin-6-yl]-3,5-dimethyl-1,2-oxazole |
| SMILES | Cc1noc(C)c1-c1cnc2c(I)cn(Cc3ncccn3)c2c1 |
| InChI | InChI=1S/C17H14IN5O/c1-10-16(11(2)24-22-10)12-6-14-17(21-7-12)13(18)8-23(14)9-15-19-4-3-5-20-15/h3-8H,9H2,1-2H3 |
| InChIKey | BPAUVPPGYFOHKS-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 69.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.24 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|