About 2-dibutoxyphosphoryl-N,N-dioctylacetamide
2-dibutoxyphosphoryl-N,N-dioctylacetamide (PubChem CID 118060028) has the molecular formula C26H54NO4P
and a molecular weight of 475.70 g/mol. Its IUPAC name is 2-dibutoxyphosphoryl-N,N-dioctylacetamide.
Molecular Properties
| Compound Name | 2-dibutoxyphosphoryl-N,N-dioctylacetamide |
| PubChem CID | 118060028 |
| Molecular Formula | C26H54NO4P |
| Molecular Weight | 475.70 g/mol |
| Exact Mass | 475.38 |
| IUPAC Name | 2-dibutoxyphosphoryl-N,N-dioctylacetamide |
| SMILES | CCCCCCCCN(CCCCCCCC)C(=O)CP(=O)(OCCCC)OCCCC |
| InChI | InChI=1S/C26H54NO4P/c1-5-9-13-15-17-19-21-27(22-20-18-16-14-10-6-2)26(28)25-32(29,30-23-11-7-3)31-24-12-8-4/h5-25H2,1-4H3 |
| InChIKey | LPSIFUNHNHYJMV-UHFFFAOYSA-N |
| XLogP | 8.36 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 475.70 |
| LogP ≤ 5 | 8.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2-dibutoxyphosphoryl-N,N-dioctylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-dibutoxyphosphoryl-N,N-dioctylacetamide?
The IUPAC name of 2-dibutoxyphosphoryl-N,N-dioctylacetamide (CID 118060028) is 2-dibutoxyphosphoryl-N,N-dioctylacetamide.
What is the SMILES notation for 2-dibutoxyphosphoryl-N,N-dioctylacetamide?
The canonical SMILES for 2-dibutoxyphosphoryl-N,N-dioctylacetamide is CCCCCCCCN(CCCCCCCC)C(=O)CP(=O)(OCCCC)OCCCC.
What is the InChIKey of 2-dibutoxyphosphoryl-N,N-dioctylacetamide?
The InChIKey is LPSIFUNHNHYJMV-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H54NO4P/c1-5-9-13-15-17-19-21-27(22-20-18-16-14-10-6-2)26(28)25-32(29,30-23-11-7-3)31-24-12-8-4/h5-25H2,1-4H3.
What are the key properties of 2-dibutoxyphosphoryl-N,N-dioctylacetamide?
2-dibutoxyphosphoryl-N,N-dioctylacetamide has a molecular weight of 475.70 g/mol, XLogP of 8.36, 24 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-dibutoxyphosphoryl-N,N-dioctylacetamide is sourced from PubChem (CID 118060028), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).