C11H16O4 — CID 11806004
(3aS,4R,7R,7aS)-7-hydroxy-4-(methoxymethyl)-6-methyl-3a,4,7,7a-tetrahydro-1-benzofuran-3-one (PubChem CID 11806004) has the molecular formula C11H16O4 and a molecular weight of 212.24 g/mol. Its IUPAC name is (3aS,4R,7R,7aS)-7-hydroxy-4-(methoxymethyl)-6-methyl-3a,4,7,7a-tetrahydro-1-benzofuran-3-one.
| Compound Name | (3aS,4R,7R,7aS)-7-hydroxy-4-(methoxymethyl)-6-methyl-3a,4,7,7a-tetrahydro-1-benzofuran-3-one |
|---|---|
| PubChem CID | 11806004 |
| Molecular Formula | C11H16O4 |
| Molecular Weight | 212.24 g/mol |
| Exact Mass | 212.10 |
| IUPAC Name | (3aS,4R,7R,7aS)-7-hydroxy-4-(methoxymethyl)-6-methyl-3a,4,7,7a-tetrahydro-1-benzofuran-3-one |
| SMILES | COC[C@@H]1C=C(C)[C@@H](O)[C@H]2OCC(=O)[C@H]21 |
| InChI | InChI=1S/C11H16O4/c1-6-3-7(4-14-2)9-8(12)5-15-11(9)10(6)13/h3,7,9-11,13H,4-5H2,1-2H3/t7-,9+,10+,11-/m0/s1 |
| InChIKey | DNHYCXFDVPZWKE-IANFPDNMSA-N |
| XLogP | 0.15 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.24 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|