C26H27N7O4S — CID 118060446
N-[3-[[2-[4-[(1-methylsulfonylpyrrolidin-3-yl)amino]anilino]-7H-pyrrolo[2,3-d]pyrimidin-4-yl]oxy]phenyl]prop-2-enamide (PubChem CID 118060446) has the molecular formula C26H27N7O4S and a molecular weight of 533.61 g/mol. Its IUPAC name is N-[3-[[2-[4-[(1-methylsulfonylpyrrolidin-3-yl)amino]anilino]-7H-pyrrolo[2,3-d]pyrimidin-4-yl]oxy]phenyl]prop-2-enamide.
| Compound Name | N-[3-[[2-[4-[(1-methylsulfonylpyrrolidin-3-yl)amino]anilino]-7H-pyrrolo[2,3-d]pyrimidin-4-yl]oxy]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 118060446 |
| Molecular Formula | C26H27N7O4S |
| Molecular Weight | 533.61 g/mol |
| Exact Mass | 533.18 |
| IUPAC Name | N-[3-[[2-[4-[(1-methylsulfonylpyrrolidin-3-yl)amino]anilino]-7H-pyrrolo[2,3-d]pyrimidin-4-yl]oxy]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cccc(Oc2nc(Nc3ccc(NC4CCN(S(C)(=O)=O)C4)cc3)nc3[nH]ccc23)c1 |
| InChI | InChI=1S/C26H27N7O4S/c1-3-23(34)29-19-5-4-6-21(15-19)37-25-22-11-13-27-24(22)31-26(32-25)30-18-9-7-17(8-10-18)28-20-12-14-33(16-20)38(2,35)36/h3-11,13,15,20,28H,1,12,14,16H2,2H3,(H,29,34)(H2,27,30,31,32) |
| InChIKey | DJBCVGGTKGCEKX-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 141.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.61 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|