C32H38N8O4 — CID 118060482
N-[3-[2-[4-[[(3S)-1-(2-methoxyethyl)pyrrolidin-3-yl]amino]anilino]-9-(oxan-2-yl)purin-6-yl]oxyphenyl]prop-2-enamide (PubChem CID 118060482) has the molecular formula C32H38N8O4 and a molecular weight of 598.71 g/mol. Its IUPAC name is N-[3-[2-[4-[[(3S)-1-(2-methoxyethyl)pyrrolidin-3-yl]amino]anilino]-9-(oxan-2-yl)purin-6-yl]oxyphenyl]prop-2-enamide.
| Compound Name | N-[3-[2-[4-[[(3S)-1-(2-methoxyethyl)pyrrolidin-3-yl]amino]anilino]-9-(oxan-2-yl)purin-6-yl]oxyphenyl]prop-2-enamide |
|---|---|
| PubChem CID | 118060482 |
| Molecular Formula | C32H38N8O4 |
| Molecular Weight | 598.71 g/mol |
| Exact Mass | 598.30 |
| IUPAC Name | N-[3-[2-[4-[[(3S)-1-(2-methoxyethyl)pyrrolidin-3-yl]amino]anilino]-9-(oxan-2-yl)purin-6-yl]oxyphenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cccc(Oc2nc(Nc3ccc(N[C@H]4CCN(CCOC)C4)cc3)nc3c2ncn3C2CCCCO2)c1 |
| InChI | InChI=1S/C32H38N8O4/c1-3-27(41)35-24-7-6-8-26(19-24)44-31-29-30(40(21-33-29)28-9-4-5-17-43-28)37-32(38-31)36-23-12-10-22(11-13-23)34-25-14-15-39(20-25)16-18-42-2/h3,6-8,10-13,19,21,25,28,34H,1,4-5,9,14-18,20H2,2H3,(H,35,41)(H,36,37,38)/t25-,28?/m0/s1 |
| InChIKey | HYSSUERISNABKT-ALLRNTDFSA-N |
| XLogP | 5.32 |
| TPSA | 127.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.71 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|