About (5R)-5-(2,2-dimethoxyethyl)-6-methylhept-6-en-2-one
(5R)-5-(2,2-dimethoxyethyl)-6-methylhept-6-en-2-one (PubChem CID 11806063) has the molecular formula C12H22O3
and a molecular weight of 214.30 g/mol. Its IUPAC name is (5R)-5-(2,2-dimethoxyethyl)-6-methylhept-6-en-2-one.
Molecular Properties
| Compound Name | (5R)-5-(2,2-dimethoxyethyl)-6-methylhept-6-en-2-one |
| PubChem CID | 11806063 |
| Molecular Formula | C12H22O3 |
| Molecular Weight | 214.30 g/mol |
| Exact Mass | 214.16 |
| IUPAC Name | (5R)-5-(2,2-dimethoxyethyl)-6-methylhept-6-en-2-one |
| SMILES | C=C(C)[C@H](CCC(C)=O)CC(OC)OC |
| InChI | InChI=1S/C12H22O3/c1-9(2)11(7-6-10(3)13)8-12(14-4)15-5/h11-12H,1,6-8H2,2-5H3/t11-/m1/s1 |
| InChIKey | XWNDTRQJGOFJPG-LLVKDONJSA-N |
| XLogP | 2.56 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.30 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (5R)-5-(2,2-dimethoxyethyl)-6-methylhept-6-en-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5R)-5-(2,2-dimethoxyethyl)-6-methylhept-6-en-2-one?
The IUPAC name of (5R)-5-(2,2-dimethoxyethyl)-6-methylhept-6-en-2-one (CID 11806063) is (5R)-5-(2,2-dimethoxyethyl)-6-methylhept-6-en-2-one.
What is the SMILES notation for (5R)-5-(2,2-dimethoxyethyl)-6-methylhept-6-en-2-one?
The canonical SMILES for (5R)-5-(2,2-dimethoxyethyl)-6-methylhept-6-en-2-one is C=C(C)[C@H](CCC(C)=O)CC(OC)OC.
What is the InChIKey of (5R)-5-(2,2-dimethoxyethyl)-6-methylhept-6-en-2-one?
The InChIKey is XWNDTRQJGOFJPG-LLVKDONJSA-N. The full InChI is InChI=1S/C12H22O3/c1-9(2)11(7-6-10(3)13)8-12(14-4)15-5/h11-12H,1,6-8H2,2-5H3/t11-/m1/s1.
What are the key properties of (5R)-5-(2,2-dimethoxyethyl)-6-methylhept-6-en-2-one?
(5R)-5-(2,2-dimethoxyethyl)-6-methylhept-6-en-2-one has a molecular weight of 214.30 g/mol, XLogP of 2.56, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (5R)-5-(2,2-dimethoxyethyl)-6-methylhept-6-en-2-one is sourced from PubChem (CID 11806063), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).