C32H39N7O6 — CID 118060704
[2-[4-[[(3S)-1-(2-methoxyethyl)pyrrolidin-3-yl]-methylamino]anilino]-4-(3-nitrophenoxy)pyrrolo[2,3-d]pyrimidin-7-yl]methyl 2,2-dimethylpropanoate (PubChem CID 118060704) has the molecular formula C32H39N7O6 and a molecular weight of 617.71 g/mol. Its IUPAC name is [2-[4-[[(3S)-1-(2-methoxyethyl)pyrrolidin-3-yl]-methylamino]anilino]-4-(3-nitrophenoxy)pyrrolo[2,3-d]pyrimidin-7-yl]methyl 2,2-dimethylpropanoate.
| Compound Name | [2-[4-[[(3S)-1-(2-methoxyethyl)pyrrolidin-3-yl]-methylamino]anilino]-4-(3-nitrophenoxy)pyrrolo[2,3-d]pyrimidin-7-yl]methyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 118060704 |
| Molecular Formula | C32H39N7O6 |
| Molecular Weight | 617.71 g/mol |
| Exact Mass | 617.30 |
| IUPAC Name | [2-[4-[[(3S)-1-(2-methoxyethyl)pyrrolidin-3-yl]-methylamino]anilino]-4-(3-nitrophenoxy)pyrrolo[2,3-d]pyrimidin-7-yl]methyl 2,2-dimethylpropanoate |
| SMILES | COCCN1CC[C@H](N(C)c2ccc(Nc3nc(Oc4cccc([N+](=O)[O-])c4)c4ccn(COC(=O)C(C)(C)C)c4n3)cc2)C1 |
| InChI | InChI=1S/C32H39N7O6/c1-32(2,3)30(40)44-21-38-16-14-27-28(38)34-31(35-29(27)45-26-8-6-7-24(19-26)39(41)42)33-22-9-11-23(12-10-22)36(4)25-13-15-37(20-25)17-18-43-5/h6-12,14,16,19,25H,13,15,17-18,20-21H2,1-5H3,(H,33,34,35)/t25-/m0/s1 |
| InChIKey | NJKHQZMGPPZDLS-VWLOTQADSA-N |
| XLogP | 5.58 |
| TPSA | 137.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.71 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|