C25H25N7OS — CID 118060845
4-(1H-indazol-5-ylamino)-N-methyl-N-[(1-methylpyrrol-2-yl)methyl]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine-7-carboxamide (PubChem CID 118060845) has the molecular formula C25H25N7OS and a molecular weight of 471.59 g/mol. Its IUPAC name is 4-(1H-indazol-5-ylamino)-N-methyl-N-[(1-methylpyrrol-2-yl)methyl]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine-7-carboxamide.
| Compound Name | 4-(1H-indazol-5-ylamino)-N-methyl-N-[(1-methylpyrrol-2-yl)methyl]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine-7-carboxamide |
|---|---|
| PubChem CID | 118060845 |
| Molecular Formula | C25H25N7OS |
| Molecular Weight | 471.59 g/mol |
| Exact Mass | 471.18 |
| IUPAC Name | 4-(1H-indazol-5-ylamino)-N-methyl-N-[(1-methylpyrrol-2-yl)methyl]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine-7-carboxamide |
| SMILES | CN(Cc1cccn1C)C(=O)C1CCc2c(sc3ncnc(Nc4ccc5[nH]ncc5c4)c23)C1 |
| InChI | InChI=1S/C25H25N7OS/c1-31-9-3-4-18(31)13-32(2)25(33)15-5-7-19-21(11-15)34-24-22(19)23(26-14-27-24)29-17-6-8-20-16(10-17)12-28-30-20/h3-4,6,8-10,12,14-15H,5,7,11,13H2,1-2H3,(H,28,30)(H,26,27,29) |
| InChIKey | JBSITGHEYBVYTJ-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 91.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.59 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |