C29H29F3N8O3 — CID 118061188
N-[3-(7-benzyl-1-oxo-2,7-diazaspiro[4.4]nonan-2-yl)-1-methylpyrazol-4-yl]-2-[2-(2,2,2-trifluoroethylamino)-4-pyridinyl]-1,3-oxazole-4-carboxamide (PubChem CID 118061188) has the molecular formula C29H29F3N8O3 and a molecular weight of 594.60 g/mol. Its IUPAC name is N-[3-(7-benzyl-1-oxo-2,7-diazaspiro[4.4]nonan-2-yl)-1-methylpyrazol-4-yl]-2-[2-(2,2,2-trifluoroethylamino)-4-pyridinyl]-1,3-oxazole-4-carboxamide.
| Compound Name | N-[3-(7-benzyl-1-oxo-2,7-diazaspiro[4.4]nonan-2-yl)-1-methylpyrazol-4-yl]-2-[2-(2,2,2-trifluoroethylamino)-4-pyridinyl]-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 118061188 |
| Molecular Formula | C29H29F3N8O3 |
| Molecular Weight | 594.60 g/mol |
| Exact Mass | 594.23 |
| IUPAC Name | N-[3-(7-benzyl-1-oxo-2,7-diazaspiro[4.4]nonan-2-yl)-1-methylpyrazol-4-yl]-2-[2-(2,2,2-trifluoroethylamino)-4-pyridinyl]-1,3-oxazole-4-carboxamide |
| SMILES | Cn1cc(NC(=O)c2coc(-c3ccnc(NCC(F)(F)F)c3)n2)c(N2CCC3(CCN(Cc4ccccc4)C3)C2=O)n1 |
| InChI | InChI=1S/C29H29F3N8O3/c1-38-15-21(35-25(41)22-16-43-26(36-22)20-7-10-33-23(13-20)34-17-29(30,31)32)24(37-38)40-12-9-28(27(40)42)8-11-39(18-28)14-19-5-3-2-4-6-19/h2-7,10,13,15-16H,8-9,11-12,14,17-18H2,1H3,(H,33,34)(H,35,41) |
| InChIKey | RQWKFCGOKJXJIC-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 121.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.60 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |