About 1-ethyl-2,4-dimethyl-1H-imidazol-1-ium nitrate
1-ethyl-2,4-dimethyl-1H-imidazol-1-ium nitrate (PubChem CID 118061880) has the molecular formula C7H13N3O3
and a molecular weight of 187.20 g/mol. Its IUPAC name is 1-ethyl-2,4-dimethyl-1H-imidazol-1-ium nitrate.
Molecular Properties
| Compound Name | 1-ethyl-2,4-dimethyl-1H-imidazol-1-ium nitrate |
| PubChem CID | 118061880 |
| Molecular Formula | C7H13N3O3 |
| Molecular Weight | 187.20 g/mol |
| Exact Mass | 187.10 |
| IUPAC Name | 1-ethyl-2,4-dimethyl-1H-imidazol-1-ium nitrate |
| SMILES | CC[NH+]1C=C(C)N=C1C.O=[N+]([O-])[O-] |
| InChI | InChI=1S/C7H12N2.NO3/c1-4-9-5-6(2)8-7(9)3;2-1(3)4/h5H,4H2,1-3H3;/q;-1/p+1 |
| InChIKey | IXXAHGWUSKUERV-UHFFFAOYSA-O |
| XLogP | -0.05 |
| TPSA | 83.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.20 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-ethyl-2,4-dimethyl-1H-imidazol-1-ium nitrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-2,4-dimethyl-1H-imidazol-1-ium nitrate?
The IUPAC name of 1-ethyl-2,4-dimethyl-1H-imidazol-1-ium nitrate (CID 118061880) is 1-ethyl-2,4-dimethyl-1H-imidazol-1-ium nitrate.
What is the SMILES notation for 1-ethyl-2,4-dimethyl-1H-imidazol-1-ium nitrate?
The canonical SMILES for 1-ethyl-2,4-dimethyl-1H-imidazol-1-ium nitrate is CC[NH+]1C=C(C)N=C1C.O=[N+]([O-])[O-].
What is the InChIKey of 1-ethyl-2,4-dimethyl-1H-imidazol-1-ium nitrate?
The InChIKey is IXXAHGWUSKUERV-UHFFFAOYSA-O. The full InChI is InChI=1S/C7H12N2.NO3/c1-4-9-5-6(2)8-7(9)3;2-1(3)4/h5H,4H2,1-3H3;/q;-1/p+1.
What are the key properties of 1-ethyl-2,4-dimethyl-1H-imidazol-1-ium nitrate?
1-ethyl-2,4-dimethyl-1H-imidazol-1-ium nitrate has a molecular weight of 187.20 g/mol, XLogP of -0.05, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-2,4-dimethyl-1H-imidazol-1-ium nitrate is sourced from PubChem (CID 118061880), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).