C21H23N5O — CID 118062004
(6S)-4-(2,3-dihydroindol-1-yl)-N-ethyl-6,7,8,9-tetrahydro-5H-pyrimido[4,5-b]indole-6-carboxamide (PubChem CID 118062004) has the molecular formula C21H23N5O and a molecular weight of 361.45 g/mol. Its IUPAC name is (6S)-4-(2,3-dihydroindol-1-yl)-N-ethyl-6,7,8,9-tetrahydro-5H-pyrimido[4,5-b]indole-6-carboxamide.
| Compound Name | (6S)-4-(2,3-dihydroindol-1-yl)-N-ethyl-6,7,8,9-tetrahydro-5H-pyrimido[4,5-b]indole-6-carboxamide |
|---|---|
| PubChem CID | 118062004 |
| Molecular Formula | C21H23N5O |
| Molecular Weight | 361.45 g/mol |
| Exact Mass | 361.19 |
| IUPAC Name | (6S)-4-(2,3-dihydroindol-1-yl)-N-ethyl-6,7,8,9-tetrahydro-5H-pyrimido[4,5-b]indole-6-carboxamide |
| SMILES | CCNC(=O)[C@H]1CCc2[nH]c3ncnc(N4CCc5ccccc54)c3c2C1 |
| InChI | InChI=1S/C21H23N5O/c1-2-22-21(27)14-7-8-16-15(11-14)18-19(25-16)23-12-24-20(18)26-10-9-13-5-3-4-6-17(13)26/h3-6,12,14H,2,7-11H2,1H3,(H,22,27)(H,23,24,25)/t14-/m0/s1 |
| InChIKey | ZGLMKWMTVZRSIC-AWEZNQCLSA-N |
| XLogP | 2.89 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.45 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |