C13H16O3 — CID 11806209
(1S,8R,9R,12S,13R)-12-methyl-11,14-dioxatetracyclo[6.5.1.02,7.09,13]tetradec-2(7)-en-10-one (PubChem CID 11806209) has the molecular formula C13H16O3 and a molecular weight of 220.27 g/mol. Its IUPAC name is (1S,8R,9R,12S,13R)-12-methyl-11,14-dioxatetracyclo[6.5.1.02,7.09,13]tetradec-2(7)-en-10-one.
| Compound Name | (1S,8R,9R,12S,13R)-12-methyl-11,14-dioxatetracyclo[6.5.1.02,7.09,13]tetradec-2(7)-en-10-one |
|---|---|
| PubChem CID | 11806209 |
| Molecular Formula | C13H16O3 |
| Molecular Weight | 220.27 g/mol |
| Exact Mass | 220.11 |
| IUPAC Name | (1S,8R,9R,12S,13R)-12-methyl-11,14-dioxatetracyclo[6.5.1.02,7.09,13]tetradec-2(7)-en-10-one |
| SMILES | C[C@@H]1OC(=O)[C@@H]2[C@H]1[C@@H]1O[C@H]2C2=C1CCCC2 |
| InChI | InChI=1S/C13H16O3/c1-6-9-10(13(14)15-6)12-8-5-3-2-4-7(8)11(9)16-12/h6,9-12H,2-5H2,1H3/t6-,9-,10+,11+,12-/m0/s1 |
| InChIKey | CJQHVPXJEUTTSY-UOAXWKJLSA-N |
| XLogP | 1.82 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.27 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|