C21H23F2N5O3S — CID 118062112
(6S)-4-(2,3-difluoroanilino)-N-(3-methylsulfonylpropyl)-6,7,8,9-tetrahydro-5H-pyrimido[4,5-b]indole-6-carboxamide (PubChem CID 118062112) has the molecular formula C21H23F2N5O3S and a molecular weight of 463.51 g/mol. Its IUPAC name is (6S)-4-(2,3-difluoroanilino)-N-(3-methylsulfonylpropyl)-6,7,8,9-tetrahydro-5H-pyrimido[4,5-b]indole-6-carboxamide.
| Compound Name | (6S)-4-(2,3-difluoroanilino)-N-(3-methylsulfonylpropyl)-6,7,8,9-tetrahydro-5H-pyrimido[4,5-b]indole-6-carboxamide |
|---|---|
| PubChem CID | 118062112 |
| Molecular Formula | C21H23F2N5O3S |
| Molecular Weight | 463.51 g/mol |
| Exact Mass | 463.15 |
| IUPAC Name | (6S)-4-(2,3-difluoroanilino)-N-(3-methylsulfonylpropyl)-6,7,8,9-tetrahydro-5H-pyrimido[4,5-b]indole-6-carboxamide |
| SMILES | CS(=O)(=O)CCCNC(=O)[C@H]1CCc2[nH]c3ncnc(Nc4cccc(F)c4F)c3c2C1 |
| InChI | InChI=1S/C21H23F2N5O3S/c1-32(30,31)9-3-8-24-21(29)12-6-7-15-13(10-12)17-19(27-15)25-11-26-20(17)28-16-5-2-4-14(22)18(16)23/h2,4-5,11-12H,3,6-10H2,1H3,(H,24,29)(H2,25,26,27,28)/t12-/m0/s1 |
| InChIKey | JHVUBYVOEHVHTP-LBPRGKRZSA-N |
| XLogP | 2.64 |
| TPSA | 116.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.51 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|