C20H15F4N5O2 — CID 118062178
2-(3-fluorophenyl)-5-N-(3,4,5-trifluorophenyl)-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine-3,5-dicarboxamide (PubChem CID 118062178) has the molecular formula C20H15F4N5O2 and a molecular weight of 433.37 g/mol. Its IUPAC name is 2-(3-fluorophenyl)-5-N-(3,4,5-trifluorophenyl)-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine-3,5-dicarboxamide.
| Compound Name | 2-(3-fluorophenyl)-5-N-(3,4,5-trifluorophenyl)-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine-3,5-dicarboxamide |
|---|---|
| PubChem CID | 118062178 |
| Molecular Formula | C20H15F4N5O2 |
| Molecular Weight | 433.37 g/mol |
| Exact Mass | 433.12 |
| IUPAC Name | 2-(3-fluorophenyl)-5-N-(3,4,5-trifluorophenyl)-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine-3,5-dicarboxamide |
| SMILES | NC(=O)c1c(-c2cccc(F)c2)nn2c1CN(C(=O)Nc1cc(F)c(F)c(F)c1)CC2 |
| InChI | InChI=1S/C20H15F4N5O2/c21-11-3-1-2-10(6-11)18-16(19(25)30)15-9-28(4-5-29(15)27-18)20(31)26-12-7-13(22)17(24)14(23)8-12/h1-3,6-8H,4-5,9H2,(H2,25,30)(H,26,31) |
| InChIKey | LBLVEPCDRGVGGI-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 93.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.37 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|