About 2-(5-methoxy-2,3-dihydro-1H-indol-3-yl)-N,N-dimethylethanamine
2-(5-methoxy-2,3-dihydro-1H-indol-3-yl)-N,N-dimethylethanamine (PubChem CID 11806221) has the molecular formula C13H20N2O
and a molecular weight of 220.32 g/mol. Its IUPAC name is 2-(5-methoxy-2,3-dihydro-1H-indol-3-yl)-N,N-dimethylethanamine.
Molecular Properties
| Compound Name | 2-(5-methoxy-2,3-dihydro-1H-indol-3-yl)-N,N-dimethylethanamine |
| PubChem CID | 11806221 |
| Molecular Formula | C13H20N2O |
| Molecular Weight | 220.32 g/mol |
| Exact Mass | 220.16 |
| IUPAC Name | 2-(5-methoxy-2,3-dihydro-1H-indol-3-yl)-N,N-dimethylethanamine |
| SMILES | COc1ccc2c(c1)C(CCN(C)C)CN2 |
| InChI | InChI=1S/C13H20N2O/c1-15(2)7-6-10-9-14-13-5-4-11(16-3)8-12(10)13/h4-5,8,10,14H,6-7,9H2,1-3H3 |
| InChIKey | KLJAXTVFYKOOCM-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.32 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|
Analyze 2-(5-methoxy-2,3-dihydro-1H-indol-3-yl)-N,N-dimethylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5-methoxy-2,3-dihydro-1H-indol-3-yl)-N,N-dimethylethanamine?
The IUPAC name of 2-(5-methoxy-2,3-dihydro-1H-indol-3-yl)-N,N-dimethylethanamine (CID 11806221) is 2-(5-methoxy-2,3-dihydro-1H-indol-3-yl)-N,N-dimethylethanamine.
What is the SMILES notation for 2-(5-methoxy-2,3-dihydro-1H-indol-3-yl)-N,N-dimethylethanamine?
The canonical SMILES for 2-(5-methoxy-2,3-dihydro-1H-indol-3-yl)-N,N-dimethylethanamine is COc1ccc2c(c1)C(CCN(C)C)CN2.
What is the InChIKey of 2-(5-methoxy-2,3-dihydro-1H-indol-3-yl)-N,N-dimethylethanamine?
The InChIKey is KLJAXTVFYKOOCM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20N2O/c1-15(2)7-6-10-9-14-13-5-4-11(16-3)8-12(10)13/h4-5,8,10,14H,6-7,9H2,1-3H3.
What are the key properties of 2-(5-methoxy-2,3-dihydro-1H-indol-3-yl)-N,N-dimethylethanamine?
2-(5-methoxy-2,3-dihydro-1H-indol-3-yl)-N,N-dimethylethanamine has a molecular weight of 220.32 g/mol, XLogP of 2.16, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-methoxy-2,3-dihydro-1H-indol-3-yl)-N,N-dimethylethanamine is sourced from PubChem (CID 11806221), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).