C15H19ClN4O3S — CID 118062260
(6S)-4-chloro-N-(3-methylsulfonylpropyl)-6,7,8,9-tetrahydro-5H-pyrimido[4,5-b]indole-6-carboxamide (PubChem CID 118062260) has the molecular formula C15H19ClN4O3S and a molecular weight of 370.86 g/mol. Its IUPAC name is (6S)-4-chloro-N-(3-methylsulfonylpropyl)-6,7,8,9-tetrahydro-5H-pyrimido[4,5-b]indole-6-carboxamide.
| Compound Name | (6S)-4-chloro-N-(3-methylsulfonylpropyl)-6,7,8,9-tetrahydro-5H-pyrimido[4,5-b]indole-6-carboxamide |
|---|---|
| PubChem CID | 118062260 |
| Molecular Formula | C15H19ClN4O3S |
| Molecular Weight | 370.86 g/mol |
| Exact Mass | 370.09 |
| IUPAC Name | (6S)-4-chloro-N-(3-methylsulfonylpropyl)-6,7,8,9-tetrahydro-5H-pyrimido[4,5-b]indole-6-carboxamide |
| SMILES | CS(=O)(=O)CCCNC(=O)[C@H]1CCc2[nH]c3ncnc(Cl)c3c2C1 |
| InChI | InChI=1S/C15H19ClN4O3S/c1-24(22,23)6-2-5-17-15(21)9-3-4-11-10(7-9)12-13(16)18-8-19-14(12)20-11/h8-9H,2-7H2,1H3,(H,17,21)(H,18,19,20)/t9-/m0/s1 |
| InChIKey | BDTZAWGKAOCFGB-VIFPVBQESA-N |
| XLogP | 1.27 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.86 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|