About 2-(dimethylamino)ethyl 2-oxo-2-phenylacetate
2-(dimethylamino)ethyl 2-oxo-2-phenylacetate (PubChem CID 11806246) has the molecular formula C12H15NO3
and a molecular weight of 221.26 g/mol. Its IUPAC name is 2-(dimethylamino)ethyl 2-oxo-2-phenylacetate.
Molecular Properties
| Compound Name | 2-(dimethylamino)ethyl 2-oxo-2-phenylacetate |
| PubChem CID | 11806246 |
| Molecular Formula | C12H15NO3 |
| Molecular Weight | 221.26 g/mol |
| Exact Mass | 221.11 |
| IUPAC Name | 2-(dimethylamino)ethyl 2-oxo-2-phenylacetate |
| SMILES | CN(C)CCOC(=O)C(=O)c1ccccc1 |
| InChI | InChI=1S/C12H15NO3/c1-13(2)8-9-16-12(15)11(14)10-6-4-3-5-7-10/h3-7H,8-9H2,1-2H3 |
| InChIKey | OQTMRMNQFOOEJZ-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.26 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 2-(dimethylamino)ethyl 2-oxo-2-phenylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(dimethylamino)ethyl 2-oxo-2-phenylacetate?
The IUPAC name of 2-(dimethylamino)ethyl 2-oxo-2-phenylacetate (CID 11806246) is 2-(dimethylamino)ethyl 2-oxo-2-phenylacetate.
What is the SMILES notation for 2-(dimethylamino)ethyl 2-oxo-2-phenylacetate?
The canonical SMILES for 2-(dimethylamino)ethyl 2-oxo-2-phenylacetate is CN(C)CCOC(=O)C(=O)c1ccccc1.
What is the InChIKey of 2-(dimethylamino)ethyl 2-oxo-2-phenylacetate?
The InChIKey is OQTMRMNQFOOEJZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15NO3/c1-13(2)8-9-16-12(15)11(14)10-6-4-3-5-7-10/h3-7H,8-9H2,1-2H3.
What are the key properties of 2-(dimethylamino)ethyl 2-oxo-2-phenylacetate?
2-(dimethylamino)ethyl 2-oxo-2-phenylacetate has a molecular weight of 221.26 g/mol, XLogP of 0.97, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(dimethylamino)ethyl 2-oxo-2-phenylacetate is sourced from PubChem (CID 11806246), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).