C22H25N9O3S — CID 118062582
(6S)-N-(3-methylsulfonylpropyl)-4-[3-(tetrazol-1-yl)anilino]-6,7,8,9-tetrahydro-5H-pyrimido[4,5-b]indole-6-carboxamide (PubChem CID 118062582) has the molecular formula C22H25N9O3S and a molecular weight of 495.57 g/mol. Its IUPAC name is (6S)-N-(3-methylsulfonylpropyl)-4-[3-(tetrazol-1-yl)anilino]-6,7,8,9-tetrahydro-5H-pyrimido[4,5-b]indole-6-carboxamide.
| Compound Name | (6S)-N-(3-methylsulfonylpropyl)-4-[3-(tetrazol-1-yl)anilino]-6,7,8,9-tetrahydro-5H-pyrimido[4,5-b]indole-6-carboxamide |
|---|---|
| PubChem CID | 118062582 |
| Molecular Formula | C22H25N9O3S |
| Molecular Weight | 495.57 g/mol |
| Exact Mass | 495.18 |
| IUPAC Name | (6S)-N-(3-methylsulfonylpropyl)-4-[3-(tetrazol-1-yl)anilino]-6,7,8,9-tetrahydro-5H-pyrimido[4,5-b]indole-6-carboxamide |
| SMILES | CS(=O)(=O)CCCNC(=O)[C@H]1CCc2[nH]c3ncnc(Nc4cccc(-n5cnnn5)c4)c3c2C1 |
| InChI | InChI=1S/C22H25N9O3S/c1-35(33,34)9-3-8-23-22(32)14-6-7-18-17(10-14)19-20(24-12-25-21(19)28-18)27-15-4-2-5-16(11-15)31-13-26-29-30-31/h2,4-5,11-14H,3,6-10H2,1H3,(H,23,32)(H2,24,25,27,28)/t14-/m0/s1 |
| InChIKey | LWGZRYZMOLEJSA-AWEZNQCLSA-N |
| XLogP | 1.33 |
| TPSA | 160.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.57 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|