C15H31N2+ — CID 118062899
2,2,3,3,4,5-hexaethyl-1H-imidazol-3-ium (PubChem CID 118062899) has the molecular formula C15H31N2+ and a molecular weight of 239.43 g/mol. Its IUPAC name is 2,2,3,3,4,5-hexaethyl-1H-imidazol-3-ium.
| Compound Name | 2,2,3,3,4,5-hexaethyl-1H-imidazol-3-ium |
|---|---|
| PubChem CID | 118062899 |
| Molecular Formula | C15H31N2+ |
| Molecular Weight | 239.43 g/mol |
| Exact Mass | 239.25 |
| IUPAC Name | 2,2,3,3,4,5-hexaethyl-1H-imidazol-3-ium |
| SMILES | CCC1=C(CC)[N+](CC)(CC)C(CC)(CC)N1 |
| InChI | InChI=1S/C15H31N2/c1-7-13-14(8-2)17(11-5,12-6)15(9-3,10-4)16-13/h16H,7-12H2,1-6H3/q+1 |
| InChIKey | VPSASRHGIHIXHY-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.43 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|