C17H17F2N3O2S — CID 118062960
8a-(2,4-difluorophenyl)-4-methyl-6-(1,3-oxazol-2-yl)-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-2-amine (PubChem CID 118062960) has the molecular formula C17H17F2N3O2S and a molecular weight of 365.41 g/mol. Its IUPAC name is 8a-(2,4-difluorophenyl)-4-methyl-6-(1,3-oxazol-2-yl)-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-2-amine.
| Compound Name | 8a-(2,4-difluorophenyl)-4-methyl-6-(1,3-oxazol-2-yl)-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-2-amine |
|---|---|
| PubChem CID | 118062960 |
| Molecular Formula | C17H17F2N3O2S |
| Molecular Weight | 365.41 g/mol |
| Exact Mass | 365.10 |
| IUPAC Name | 8a-(2,4-difluorophenyl)-4-methyl-6-(1,3-oxazol-2-yl)-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-2-amine |
| SMILES | CC1SC(N)=NC2(c3ccc(F)cc3F)COC(c3ncco3)CC12 |
| InChI | InChI=1S/C17H17F2N3O2S/c1-9-12-7-14(15-21-4-5-23-15)24-8-17(12,22-16(20)25-9)11-3-2-10(18)6-13(11)19/h2-6,9,12,14H,7-8H2,1H3,(H2,20,22) |
| InChIKey | UVLZAXVMVHTAGW-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 73.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.41 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |