About 2-[3-(3,4-difluoroanilino)-2-hydroxypropyl]isoindole-1,3-dione
2-[3-(3,4-difluoroanilino)-2-hydroxypropyl]isoindole-1,3-dione (PubChem CID 118063026) has the molecular formula C17H14F2N2O3
and a molecular weight of 332.31 g/mol. Its IUPAC name is 2-[3-(3,4-difluoroanilino)-2-hydroxypropyl]isoindole-1,3-dione.
Molecular Properties
| Compound Name | 2-[3-(3,4-difluoroanilino)-2-hydroxypropyl]isoindole-1,3-dione |
| PubChem CID | 118063026 |
| Molecular Formula | C17H14F2N2O3 |
| Molecular Weight | 332.31 g/mol |
| Exact Mass | 332.10 |
| IUPAC Name | 2-[3-(3,4-difluoroanilino)-2-hydroxypropyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1CC(O)CNc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C17H14F2N2O3/c18-14-6-5-10(7-15(14)19)20-8-11(22)9-21-16(23)12-3-1-2-4-13(12)17(21)24/h1-7,11,20,22H,8-9H2 |
| InChIKey | GIVSCIXIMQVZEJ-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.31 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 2-[3-(3,4-difluoroanilino)-2-hydroxypropyl]isoindole-1,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-(3,4-difluoroanilino)-2-hydroxypropyl]isoindole-1,3-dione?
The IUPAC name of 2-[3-(3,4-difluoroanilino)-2-hydroxypropyl]isoindole-1,3-dione (CID 118063026) is 2-[3-(3,4-difluoroanilino)-2-hydroxypropyl]isoindole-1,3-dione.
What is the SMILES notation for 2-[3-(3,4-difluoroanilino)-2-hydroxypropyl]isoindole-1,3-dione?
The canonical SMILES for 2-[3-(3,4-difluoroanilino)-2-hydroxypropyl]isoindole-1,3-dione is O=C1c2ccccc2C(=O)N1CC(O)CNc1ccc(F)c(F)c1.
What is the InChIKey of 2-[3-(3,4-difluoroanilino)-2-hydroxypropyl]isoindole-1,3-dione?
The InChIKey is GIVSCIXIMQVZEJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14F2N2O3/c18-14-6-5-10(7-15(14)19)20-8-11(22)9-21-16(23)12-3-1-2-4-13(12)17(21)24/h1-7,11,20,22H,8-9H2.
What are the key properties of 2-[3-(3,4-difluoroanilino)-2-hydroxypropyl]isoindole-1,3-dione?
2-[3-(3,4-difluoroanilino)-2-hydroxypropyl]isoindole-1,3-dione has a molecular weight of 332.31 g/mol, XLogP of 2.03, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-(3,4-difluoroanilino)-2-hydroxypropyl]isoindole-1,3-dione is sourced from PubChem (CID 118063026), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).