C16H15ClN6 — CID 118063119
6-chloro-4-N,4-N-bis(pyridin-2-ylmethyl)pyrimidine-2,4-diamine (PubChem CID 118063119) has the molecular formula C16H15ClN6 and a molecular weight of 326.79 g/mol. Its IUPAC name is 6-chloro-4-N,4-N-bis(pyridin-2-ylmethyl)pyrimidine-2,4-diamine.
| Compound Name | 6-chloro-4-N,4-N-bis(pyridin-2-ylmethyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 118063119 |
| Molecular Formula | C16H15ClN6 |
| Molecular Weight | 326.79 g/mol |
| Exact Mass | 326.10 |
| IUPAC Name | 6-chloro-4-N,4-N-bis(pyridin-2-ylmethyl)pyrimidine-2,4-diamine |
| SMILES | Nc1nc(Cl)cc(N(Cc2ccccn2)Cc2ccccn2)n1 |
| InChI | InChI=1S/C16H15ClN6/c17-14-9-15(22-16(18)21-14)23(10-12-5-1-3-7-19-12)11-13-6-2-4-8-20-13/h1-9H,10-11H2,(H2,18,21,22) |
| InChIKey | SYFPFTMYYZUQCF-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 80.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.79 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |