C29H28N2O2 — CID 118063257
N-[4-[4-(1-methylpiperidin-4-yl)oxyphenyl]phenyl]naphthalene-2-carboxamide (PubChem CID 118063257) has the molecular formula C29H28N2O2 and a molecular weight of 436.56 g/mol. Its IUPAC name is N-[4-[4-(1-methylpiperidin-4-yl)oxyphenyl]phenyl]naphthalene-2-carboxamide.
| Compound Name | N-[4-[4-(1-methylpiperidin-4-yl)oxyphenyl]phenyl]naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 118063257 |
| Molecular Formula | C29H28N2O2 |
| Molecular Weight | 436.56 g/mol |
| Exact Mass | 436.22 |
| IUPAC Name | N-[4-[4-(1-methylpiperidin-4-yl)oxyphenyl]phenyl]naphthalene-2-carboxamide |
| SMILES | CN1CCC(Oc2ccc(-c3ccc(NC(=O)c4ccc5ccccc5c4)cc3)cc2)CC1 |
| InChI | InChI=1S/C29H28N2O2/c1-31-18-16-28(17-19-31)33-27-14-10-23(11-15-27)22-8-12-26(13-9-22)30-29(32)25-7-6-21-4-2-3-5-24(21)20-25/h2-15,20,28H,16-19H2,1H3,(H,30,32) |
| InChIKey | YXZPNWMLCDXCHM-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.56 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |